EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N2O9 |
| Net Charge | 0 |
| Average Mass | 560.644 |
| Monoisotopic Mass | 560.27338 |
| SMILES | COC1=C2C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)/C=C\C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C29H40N2O9/c1-15-11-19-25(34)20(14-21(32)27(19)39-7)31-28(35)16(2)9-8-10-22(37-5)26(40-29(30)36)18(4)13-17(3)24(33)23(12-15)38-6/h8-10,13-15,17,22-24,26,33H,11-12H2,1-7H3,(H2,30,36)(H,31,35)/b10-8-,16-9+,18-13+/t15-,17+,22+,23+,24-,26+/m1/s1 |
| InChIKey | QTQAWLPCGQOSGP-KSRBKZBZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. cysteine protease inhibitor Any protease inhibitor that restricts the action of a cysteine protease. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geldanamycin (CHEBI:5292) has role antimicrobial agent (CHEBI:33281) |
| geldanamycin (CHEBI:5292) has role antineoplastic agent (CHEBI:35610) |
| geldanamycin (CHEBI:5292) has role antiviral agent (CHEBI:22587) |
| geldanamycin (CHEBI:5292) has role cysteine protease inhibitor (CHEBI:64152) |
| geldanamycin (CHEBI:5292) has role Hsp90 inhibitor (CHEBI:63962) |
| geldanamycin (CHEBI:5292) is a 1,4-benzoquinones (CHEBI:132124) |
| geldanamycin (CHEBI:5292) is a ansamycin (CHEBI:22565) |
| geldanamycin (CHEBI:5292) is a carbamate ester (CHEBI:23003) |
| geldanamycin (CHEBI:5292) is a organic heterobicyclic compound (CHEBI:27171) |
| Incoming Relation(s) |
| alvespimycin (CHEBI:65324) has functional parent geldanamycin (CHEBI:5292) |
| retaspimycin (CHEBI:71975) has functional parent geldanamycin (CHEBI:5292) |
| tanespimycin (CHEBI:64153) has functional parent geldanamycin (CHEBI:5292) |
| IUPAC Name |
|---|
| (4E,6Z,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |
| Synonyms | Source |
|---|---|
| Geldanamycin | KEGG COMPOUND |
| GELDANAMYCIN | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00018795 | KNApSAcK |
| C11222 | KEGG COMPOUND |
| GDM | PDBeChem |
| Geldanamycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14205884 | Reaxys |
| CAS:30562-34-6 | ChemIDplus |
| Citations |
|---|