EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48N4O8 |
| Net Charge | 0 |
| Average Mass | 616.756 |
| Monoisotopic Mass | 616.34721 |
| SMILES | CO[C@H]1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(NCCN(C)C)=C(C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@@H]1OC(N)=O)C2=O |
| InChI | InChI=1S/C32H48N4O8/c1-18-14-22-27(34-12-13-36(5)6)24(37)17-23(29(22)39)35-31(40)19(2)10-9-11-25(42-7)30(44-32(33)41)21(4)16-20(3)28(38)26(15-18)43-8/h9-11,16-18,20,25-26,28,30,34,38H,12-15H2,1-8H3,(H2,33,41)(H,35,40)/b11-9-,19-10+,21-16+/t18-,20+,25+,26+,28-,30+/m1/s1 |
| InChIKey | KUFRQPKVAWMTJO-LMZWQJSESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvespimycin (CHEBI:65324) has functional parent geldanamycin (CHEBI:5292) |
| alvespimycin (CHEBI:65324) has role Hsp90 inhibitor (CHEBI:63962) |
| alvespimycin (CHEBI:65324) is a 1,4-benzoquinones (CHEBI:132124) |
| alvespimycin (CHEBI:65324) is a ansamycin (CHEBI:22565) |
| alvespimycin (CHEBI:65324) is a carbamate ester (CHEBI:23003) |
| alvespimycin (CHEBI:65324) is a secondary amino compound (CHEBI:50995) |
| alvespimycin (CHEBI:65324) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (4E,6Z,8S,9S,10E,12S,13R,14S,16R)-19-{[2-(dimethylamino)ethyl]amino}-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |
| Synonyms | Source |
|---|---|
| 17-(dimethylaminoethylamino)-17-demethoxygeldanamycin | ChemIDplus |
| 17-DMAG | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 17-Dimethylaminoethylamino-17-demethoxygeldanamycin | Wikipedia |
| DB03080 | DrugBank |
| KOS | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9890433 | Reaxys |
| CAS:467214-20-6 | ChemIDplus |
| Citations |
|---|