EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H43N3O8 |
| Net Charge | 0 |
| Average Mass | 585.698 |
| Monoisotopic Mass | 585.30502 |
| SMILES | C=CCNC1=C2C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)/C=C\C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1 |
| InChIKey | AYUNIORJHRXIBJ-TXHRRWQRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanespimycin (CHEBI:64153) has functional parent geldanamycin (CHEBI:5292) |
| tanespimycin (CHEBI:64153) has role antineoplastic agent (CHEBI:35610) |
| tanespimycin (CHEBI:64153) has role apoptosis inducer (CHEBI:68495) |
| tanespimycin (CHEBI:64153) has role Hsp90 inhibitor (CHEBI:63962) |
| tanespimycin (CHEBI:64153) is a 1,4-benzoquinones (CHEBI:132124) |
| tanespimycin (CHEBI:64153) is a ansamycin (CHEBI:22565) |
| tanespimycin (CHEBI:64153) is a carbamate ester (CHEBI:23003) |
| tanespimycin (CHEBI:64153) is a organic heterobicyclic compound (CHEBI:27171) |
| tanespimycin (CHEBI:64153) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (4E,6Z,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-19-(prop-2-en-1-ylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |
| INNs | Source |
|---|---|
| tanespimycin | WHO MedNet |
| tanespimycina | WHO MedNet |
| tanespimycine | WHO MedNet |
| tanespimycinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17-AAG | ChEBI |
| 17AAG | ChEBI |
| 17-(Allylamino)-17-demethoxygeldanamycin | ChemIDplus |
| 17-allylaminogeldanamycin | ChEBI |
| 17-(Allylamino)geldanamycin | ChemIDplus |
| 17-demethoxy-17-(2-propenylamino)geldanamycin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 17-N-Allylamino-17-demethoxygeldanamycin | Wikipedia |
| D06650 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7402240 | Reaxys |
| CAS:75747-14-7 | ChemIDplus |
| Citations |
|---|