EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H6Br4O5 |
| Net Charge | -2 |
| Average Mass | 645.879 |
| Monoisotopic Mass | 641.69597 |
| SMILES | O=C([O-])c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c([O-])c(Br)cc12 |
| InChI | InChI=1S/C20H8Br4O5/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25/h1-6,25H,(H,27,28)/p-2 |
| InChIKey | AZXGXVQWEUFULR-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) has role fluorochrome (CHEBI:51217) |
| 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) is a benzoates (CHEBI:22718) |
| 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) is a phenolate anion (CHEBI:50525) |
| 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) is conjugate base of 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) |
| Incoming Relation(s) |
| eosin YS dye (CHEBI:52053) has part 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) |
| 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) is conjugate acid of 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) |
| IUPAC Name |
|---|
| 2-(2,4,5,7-tetrabromo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| Synonyms | Source |
|---|---|
| eosin YS(2−) | ChEBI |
| Red 21(2−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1443944 | Reaxys |
| Gmelin:350839 | Gmelin |