EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H6Br4O5.2Na |
| Net Charge | 0 |
| Average Mass | 691.859 |
| Monoisotopic Mass | 687.67441 |
| SMILES | O=C([O-])c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c([O-])c(Br)cc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H8Br4O5.2Na/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2 |
| InChIKey | SEACYXSIPDVVMV-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eosin YS dye (CHEBI:52053) has part 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) |
| eosin YS dye (CHEBI:52053) has role fluorochrome (CHEBI:51217) |
| eosin YS dye (CHEBI:52053) has role histological dye (CHEBI:77178) |
| eosin YS dye (CHEBI:52053) is a organic sodium salt (CHEBI:38700) |
| eosin YS dye (CHEBI:52053) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| disodium 2-(2,4,5,7-tetrabromo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| Synonyms | Source |
|---|---|
| 2',4',5',7'-Tetrabromo-3',6'-dihydroxyspiro(isobenzofuran-1(3H),9-'-(9H)xanthen)-3-one, disodium salt | ChemIDplus |
| Acid red 87 | ChemIDplus |
| Bromoeosine | ChemIDplus |
| C.I. 45380 | ChemIDplus |
| CI 45380 | ChEBI |
| CI 45380 (Na salt) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3586809 | Reaxys |
| CAS:17372-87-1 | ChemIDplus |
| Citations |
|---|