EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H8Br4O5 |
| Net Charge | 0 |
| Average Mass | 647.895 |
| Monoisotopic Mass | 643.71052 |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c(O)c(Br)cc12 |
| InChI | InChI=1S/C20H8Br4O5/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25/h1-6,25H,(H,27,28) |
| InChIKey | AZXGXVQWEUFULR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) is a monocarboxylic acid (CHEBI:25384) |
| 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) is a organobromine compound (CHEBI:37141) |
| 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) is a xanthene dye (CHEBI:37929) |
| 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) is conjugate acid of 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) |
| Incoming Relation(s) |
| 2',4',5',7'-tetrabromofluorescein(2−) (CHEBI:52836) is conjugate base of 2',4',5',7'-tetrabromofluorescein (CHEBI:86277) |
| IUPAC Name |
|---|
| 2-(2,4,5,7-tetrabromo-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid |
| Synonyms | Source |
|---|---|
| C.I. 45380:2 | ChemIDplus |
| Japan Red 223 | ChemIDplus |
| Red 21 | ChemIDplus |
| D & C Red No. 21 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1301597 | Reaxys |
| CAS:152-75-0 | ChemIDplus |
| Citations |
|---|