EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | O=c1c(O)c(-c2ccccc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H |
| InChIKey | VCCRNZQBSJXYJD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galangin (CHEBI:5262) has role antimicrobial agent (CHEBI:33281) |
| galangin (CHEBI:5262) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| galangin (CHEBI:5262) has role plant metabolite (CHEBI:76924) |
| galangin (CHEBI:5262) is a 7-hydroxyflavonol (CHEBI:52267) |
| galangin (CHEBI:5262) is a trihydroxyflavone (CHEBI:27116) |
| Incoming Relation(s) |
| 2-(3-benzoylphenyl)-3,5,7-trihydroxychromen-4-one (CHEBI:149478) has functional parent galangin (CHEBI:5262) |
| 3-O-methyl-8-prenylgalangin (CHEBI:2304) has functional parent galangin (CHEBI:5262) |
| 3-methylgalangin (CHEBI:1602) has functional parent galangin (CHEBI:5262) |
| 6-(3,3-dimethylallyl)galangin (CHEBI:2160) has functional parent galangin (CHEBI:5262) |
| 8-(1,1-dimethylallyl)-3-methylgalangin (CHEBI:2302) has functional parent galangin (CHEBI:5262) |
| 8-(1,1-dimethylallyl)galangin (CHEBI:2303) has functional parent galangin (CHEBI:5262) |
| galangin 3,5,7-trimethyl ether (CHEBI:5263) has functional parent galangin (CHEBI:5262) |
| glepidotin A (CHEBI:5380) has functional parent galangin (CHEBI:5262) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Galangin | KEGG COMPOUND |
| 3,5,7-Trihydroxyflavone | KEGG COMPOUND |
| 3,5,7-triOH-flavone | IUPHAR |
| 3,5,7-trihydroxy-2-phenyl-4H-benzopyran-4-one | ChemIDplus |
| norizalpinin | IUPHAR |
| teptochrysin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10044 | KEGG COMPOUND |
| CPD-13502 | MetaCyc |
| Galangin | Wikipedia |
| LMPK12111653 | LIPID MAPS |
| HMDB0029521 | HMDB |
| CN101810812 | Patent |
| KR20090124397 | Patent |
| C00004533 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:272179 | Reaxys |
| CAS:548-83-4 | KEGG COMPOUND |
| CAS:548-83-4 | ChemIDplus |
| Citations |
|---|