EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)c(O)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C20H18O5/c1-11(2)8-9-13-14(21)10-15(22)16-17(23)18(24)19(25-20(13)16)12-6-4-3-5-7-12/h3-8,10,21-22,24H,9H2,1-2H3 |
| InChIKey | WCSHKPNHOSDFGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza lepidota (ncbitaxon:47080) | leaf (BTO:0000713) | PubMed (11524125) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glepidotin A (CHEBI:5380) has functional parent galangin (CHEBI:5262) |
| glepidotin A (CHEBI:5380) has role plant metabolite (CHEBI:76924) |
| glepidotin A (CHEBI:5380) is a 7-hydroxyflavonol (CHEBI:52267) |
| glepidotin A (CHEBI:5380) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-8-(3-methylbut-2-en-1-yl)-2-phenyl-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 8-(3,3-Dimethylallyl)galangin | KEGG COMPOUND |
| 8-(3,3-DMA)galangin | KEGG COMPOUND |
| 8-Prenylgalangin | KEGG COMPOUND |
| Citations |
|---|