EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O5 |
| Net Charge | 0 |
| Average Mass | 312.321 |
| Monoisotopic Mass | 312.09977 |
| SMILES | COc1cc(OC)c2c(=O)c(OC)c(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | CBTHKWVPSIGKMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galangin 3,5,7-trimethyl ether (CHEBI:5263) has functional parent galangin (CHEBI:5262) |
| galangin 3,5,7-trimethyl ether (CHEBI:5263) has role plant metabolite (CHEBI:76924) |
| galangin 3,5,7-trimethyl ether (CHEBI:5263) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 3,5,7-trimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3,5,7-trimethoxy-2-phenylchromen-4-one | ChemIDplus |
| 3,5,7-trimethoxyflavone | ChEBI |
| Galangin 3,5,7-trimethyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001042 | KNApSAcK |
| C10045 | KEGG COMPOUND |
| LMPK12111652 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:313189 | Reaxys |
| CAS:26964-29-4 | KEGG COMPOUND |
| CAS:26964-29-4 | ChemIDplus |