EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2 |
| Net Charge | 0 |
| Average Mass | 238.334 |
| Monoisotopic Mass | 238.14700 |
| SMILES | CN1Cc2c(N)cccc2[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3/t14-/m1/s1 |
| InChIKey | XXPANQJNYNUNES-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Applications: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-nomifensine (CHEBI:521391) is a nomifensine (CHEBI:116225) |
| (R)-nomifensine (CHEBI:521391) is enantiomer of (S)-nomifensine (CHEBI:180847) |
| Incoming Relation(s) |
| (S)-nomifensine (CHEBI:180847) is enantiomer of (R)-nomifensine (CHEBI:521391) |
| IUPAC Name |
|---|
| (4R)-2-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
| Synonyms | Source |
|---|---|
| (+)-Nomifensine | ChemIDplus |
| (+)-Nomiphensine | ChemIDplus |
| (R)-1,2,3,4-Tetrahydro-2-methyl-4-phenyl-8-isoquinolinamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3593187 | Reaxys |
| CAS:89664-20-0 | ChemIDplus |
| Citations |
|---|