EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2 |
| Net Charge | 0 |
| Average Mass | 238.334 |
| Monoisotopic Mass | 238.14700 |
| SMILES | CN1Cc2c(N)cccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3 |
| InChIKey | XXPANQJNYNUNES-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nomifensine (CHEBI:116225) has role dopamine uptake inhibitor (CHEBI:51039) |
| nomifensine (CHEBI:116225) is a isoquinolines (CHEBI:24922) |
| Incoming Relation(s) |
| (R)-nomifensine (CHEBI:521391) is a nomifensine (CHEBI:116225) |
| (S)-nomifensine (CHEBI:180847) is a nomifensine (CHEBI:116225) |
| IUPAC Name |
|---|
| 2-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
| INNs | Source |
|---|---|
| nomifensina | ChemIDplus |
| nomifensinum | ChemIDplus |
| nomifensine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Methyl-4-phenyl-1,2,3,4-tetrahydro-isoquinolin-8-ylamine | ChEBI |
| D,L-nomifensine | ChEBI |
| R/S-nomifensine | ChEBI |
| (+-)-Nomifensin | ChemIDplus |
| (+-)-Nomifensine | ChemIDplus |
| 8-Amino-2-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinoline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:484561 | Reaxys |
| CAS:24526-64-5 | ChemIDplus |
| CAS:24526-64-5 | NIST Chemistry WebBook |
| Citations |
|---|