EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2 |
| Net Charge | 0 |
| Average Mass | 238.334 |
| Monoisotopic Mass | 238.14700 |
| SMILES | CN1Cc2c(N)cccc2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3/t14-/m0/s1 |
| InChIKey | XXPANQJNYNUNES-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-nomifensine (CHEBI:180847) is a nomifensine (CHEBI:116225) |
| (S)-nomifensine (CHEBI:180847) is enantiomer of (R)-nomifensine (CHEBI:521391) |
| Incoming Relation(s) |
| (R)-nomifensine (CHEBI:521391) is enantiomer of (S)-nomifensine (CHEBI:180847) |
| IUPAC Name |
|---|
| (4S)-2-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
| Synonyms | Source |
|---|---|
| (S)-1,2,3,4-tetrahydro-2-methyl-4-phenyl-8-isoquinolinamine | ChEBI |
| (-)-Nomifensine | ChemIDplus |
| nomifensine (S) | ChEBI |
| (-)-Nomiphensine | ChemIDplus |
| (S)-2-methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3593188 | Reaxys |
| CAS:89664-18-6 | ChemIDplus |
| Citations |
|---|