EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52013 - levochlorpheniramine
| Formula | C16H19ClN2 |
| Net Charge | 0 |
| Average Mass | 274.795 |
| Monoisotopic Mass | 274.12368 |
| SMILES | CN(C)CC[C@H](c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | SOYKEARSMXGVTM-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. anti-allergic agent A drug used to treat allergic reactions. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levochlorpheniramine (CHEBI:52013) is a chlorphenamine (CHEBI:52010) |
| levochlorpheniramine (CHEBI:52013) is enantiomer of dexchlorpheniramine (CHEBI:4464) |
| Incoming Relation(s) |
| dexchlorpheniramine (CHEBI:4464) is enantiomer of levochlorpheniramine (CHEBI:52013) |
| IUPAC Name |
|---|
| (3R)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| Synonyms | Source |
|---|---|
| (−)-chlorpheniramine | ChEBI |
| l-chlorpheniramine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-4008 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:87361 | Beilstein |
| Beilstein:7570195 | Beilstein |