EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52010 - chlorphenamine
| Formula | C16H19ClN2 |
| Net Charge | 0 |
| Average Mass | 274.795 |
| Monoisotopic Mass | 274.12368 |
| SMILES | CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
| InChIKey | SOYKEARSMXGVTM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorphenamine (CHEBI:52010) has role anti-allergic agent (CHEBI:50857) |
| chlorphenamine (CHEBI:52010) has role antidepressant (CHEBI:35469) |
| chlorphenamine (CHEBI:52010) has role antipruritic drug (CHEBI:59683) |
| chlorphenamine (CHEBI:52010) has role H1-receptor antagonist (CHEBI:37955) |
| chlorphenamine (CHEBI:52010) has role histamine antagonist (CHEBI:37956) |
| chlorphenamine (CHEBI:52010) has role serotonin uptake inhibitor (CHEBI:50949) |
| chlorphenamine (CHEBI:52010) is a monochlorobenzenes (CHEBI:83403) |
| chlorphenamine (CHEBI:52010) is a pyridines (CHEBI:26421) |
| chlorphenamine (CHEBI:52010) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| dexchlorpheniramine (CHEBI:4464) is a chlorphenamine (CHEBI:52010) |
| levochlorpheniramine (CHEBI:52013) is a chlorphenamine (CHEBI:52010) |
| IUPAC Name |
|---|
| 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| INNs | Source |
|---|---|
| chlorphenamine | KEGG DRUG |
| chlorphenaminum | ChemIDplus |
| clorfenamina | ChemIDplus |
| chlorphénamine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chlorpheniramine | KEGG COMPOUND |
| chlorpheniraminum | ChemIDplus |
| 2-[p-chloro-α-[2-(dimethylamino)ethyl]benzyl]pyridine | NIST Chemistry WebBook |
| Chlorphenamin | ChEBI |
| γ-(4-chlorophenyl)-N,N-dimethyl-2-pyridinepropanamine | NIST Chemistry WebBook |
| 1-(p-chlorophenyl)-1-(2-pyridyl)-3-dimethylaminopropane | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Clofeniramina | KEGG DRUG |
| Haynon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06905 | KEGG COMPOUND |
| DB01114 | DrugBank |
| D07398 | KEGG DRUG |
| US2567245 | Patent |
| US2676964 | Patent |
| US2766174 | Patent |
| Chlorpheniramine | Wikipedia |
| HMDB0001944 | HMDB |
| LSM-1263 | LINCS |
| 616 | DrugCentral |
| Citations |
|---|