EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19ClN2 |
| Net Charge | 0 |
| Average Mass | 274.795 |
| Monoisotopic Mass | 274.12368 |
| SMILES | CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
| InChIKey | SOYKEARSMXGVTM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorphenamine (CHEBI:52010) has role anti-allergic agent (CHEBI:50857) |
| chlorphenamine (CHEBI:52010) has role antidepressant (CHEBI:35469) |
| chlorphenamine (CHEBI:52010) has role antipruritic drug (CHEBI:59683) |
| chlorphenamine (CHEBI:52010) has role H1-receptor antagonist (CHEBI:37955) |
| chlorphenamine (CHEBI:52010) has role histamine antagonist (CHEBI:37956) |
| chlorphenamine (CHEBI:52010) has role serotonin uptake inhibitor (CHEBI:50949) |
| chlorphenamine (CHEBI:52010) is a monochlorobenzenes (CHEBI:83403) |
| chlorphenamine (CHEBI:52010) is a pyridines (CHEBI:26421) |
| chlorphenamine (CHEBI:52010) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| dexchlorpheniramine (CHEBI:4464) is a chlorphenamine (CHEBI:52010) |
| levochlorpheniramine (CHEBI:52013) is a chlorphenamine (CHEBI:52010) |
| IUPAC Name |
|---|
| 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| INNs | Source |
|---|---|
| chlorphenamine | KEGG DRUG |
| chlorphénamine | WHO MedNet |
| chlorphenaminum | ChemIDplus |
| clorfenamina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(p-chlorophenyl)-1-(2-pyridyl)-3-dimethylaminopropane | NIST Chemistry WebBook |
| 1-(p-chlorophenyl)-1-(2-pyridyl)-3-N,N-dimethylpropylamine | ChemIDplus |
| 2-[p-chloro-α-[2-(dimethylamino)ethyl]benzyl]pyridine | NIST Chemistry WebBook |
| 3-(p-chlorophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine | ChemIDplus |
| chlorophenylpyridamine | ChemIDplus |
| Chlorphenamin | ChEBI |
| Brand Names | Source |
|---|---|
| Clofeniramina | KEGG DRUG |
| Haynon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 616 | DrugCentral |
| C06905 | KEGG COMPOUND |
| Chlorpheniramine | Wikipedia |
| D07398 | KEGG DRUG |
| DB01114 | DrugBank |
| HMDB0001944 | HMDB |
| LSM-1263 | LINCS |
| US2567245 | Patent |
| US2676964 | Patent |
| US2766174 | Patent |
| Citations |
|---|