EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19ClN2 |
| Net Charge | 0 |
| Average Mass | 274.795 |
| Monoisotopic Mass | 274.12368 |
| SMILES | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | SOYKEARSMXGVTM-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexchlorpheniramine (CHEBI:4464) is a chlorphenamine (CHEBI:52010) |
| dexchlorpheniramine (CHEBI:4464) is enantiomer of levochlorpheniramine (CHEBI:52013) |
| Incoming Relation(s) |
| levochlorpheniramine (CHEBI:52013) is enantiomer of dexchlorpheniramine (CHEBI:4464) |
| IUPAC Name |
|---|
| (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| INNs | Source |
|---|---|
| dexchlorpheniramine | KEGG DRUG |
| dexchlorpheniraminum | ChemIDplus |
| dexclorfeniramina | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-chlorpheniramine | NIST Chemistry WebBook |
| Dexchlorpheniramine | KEGG COMPOUND |
| d-chlorpheniramine | ChemIDplus |
| (S)-(+)-2-[p-chloro-α-[2-(dimethylamino)ethyl]benzyl]pyridine | NIST Chemistry WebBook |
| (S)-γ-(4-chlorophenyl)-N,N-dimethyl-2-pyridinepropanamine | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Dapriton | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6483076 | Beilstein |
| Beilstein:87360 | Beilstein |
| CAS:25523-97-1 | NIST Chemistry WebBook |
| CAS:25523-97-1 | ChemIDplus |
| CAS:25523-97-1 | KEGG COMPOUND |