EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46NO7P |
| Net Charge | 0 |
| Average Mass | 563.672 |
| Monoisotopic Mass | 563.30119 |
| SMILES | [H][C@@]1(C2CCCCC2)C[C@@H](C(=O)O)N(C(=O)CP(=O)(CCCCc2ccccc2)OC(OC(=O)CC)C(C)C)C1 |
| InChI | InChI=1S/C30H46NO7P/c1-4-28(33)37-30(22(2)3)38-39(36,18-12-11-15-23-13-7-5-8-14-23)21-27(32)31-20-25(19-26(31)29(34)35)24-16-9-6-10-17-24/h5,7-8,13-14,22,24-26,30H,4,6,9-12,15-21H2,1-3H3,(H,34,35)/t25-,26+,30?,39?/m1/s1 |
| InChIKey | BIDNLKIUORFRQP-FKDWWROVSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosinopril (CHEBI:5163) has functional parent fosinoprilat (CHEBI:116962) |
| fosinopril (CHEBI:5163) has role antihypertensive agent (CHEBI:35674) |
| fosinopril (CHEBI:5163) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| fosinopril (CHEBI:5163) has role prodrug (CHEBI:50266) |
| fosinopril (CHEBI:5163) is a L-proline derivative (CHEBI:84186) |
| fosinopril (CHEBI:5163) is a phosphinic ester (CHEBI:26043) |
| fosinopril (CHEBI:5163) is conjugate acid of fosinopril(1−) (CHEBI:59125) |
| Incoming Relation(s) |
| fosinopril(1−) (CHEBI:59125) is conjugate base of fosinopril (CHEBI:5163) |
| IUPAC Name |
|---|
| (4S)-4-cyclohexyl-1-({[2-methyl-1-(propanoyloxy)propoxy](4-phenylbutyl)phosphoryl}acetyl)-L-proline |
| INN | Source |
|---|---|
| fosinopril | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,4S)-4-cyclohexyl-1-[2-[(2-methyl-1-propanoyloxypropoxy)-(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid | DrugBank |
| (2S,4S)-4-cyclohexyl-1-{2-[(2-methyl-1-propionyloxy-propoxy)-(4-phenyl-butyl)-phosphinoyl]-acetyl}-pyrrolidine-2-carboxylic acid | ChEBI |
| Fosinopril | KEGG COMPOUND |
| (S)-4-Cyclohexyl-1-{2-[(2-methyl-1-propionyloxy-propoxy)-(4-phenyl-butyl)-phosphinoyl]-acetyl}-pyrrolidine-2-carboxylic acid | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C07016 | KEGG COMPOUND |
| CN101367839 | Patent |
| D07992 | KEGG DRUG |
| DB00492 | DrugBank |
| EP2264039 | Patent |
| LSM-6485 | LINCS |
| US2010297711 | Patent |
| US4337201 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8176492 | Beilstein |
| CAS:98048-97-6 | KEGG COMPOUND |
| CAS:98048-97-6 | ChemIDplus |
| Citations |
|---|