EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34NO5P |
| Net Charge | 0 |
| Average Mass | 435.501 |
| Monoisotopic Mass | 435.21746 |
| SMILES | [H][C@@]1(C2CCCCC2)C[C@@H](C(=O)O)N(C(=O)CP(=O)(O)CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C23H34NO5P/c25-22(17-30(28,29)14-8-7-11-18-9-3-1-4-10-18)24-16-20(15-21(24)23(26)27)19-12-5-2-6-13-19/h1,3-4,9-10,19-21H,2,5-8,11-17H2,(H,26,27)(H,28,29)/t20-,21+/m1/s1 |
| InChIKey | WOIWWYDXDVSWAZ-RTWAWAEBSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosinoprilat (CHEBI:116962) has role antihypertensive agent (CHEBI:35674) |
| fosinoprilat (CHEBI:116962) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| fosinoprilat (CHEBI:116962) is a L-proline derivative (CHEBI:84186) |
| fosinoprilat (CHEBI:116962) is a phosphinic acids (CHEBI:26044) |
| Incoming Relation(s) |
| fosinopril (CHEBI:5163) has functional parent fosinoprilat (CHEBI:116962) |
| IUPAC Name |
|---|
| (4S)-4-cyclohexyl-1-{[hydroxy(4-phenylbutyl)phosphoryl]acetyl}-L-proline |
| INNs | Source |
|---|---|
| fosinoprilat | WHO MedNet |
| fosinoprilat | WHO MedNet |
| fosinoprilat | ChemIDplus |
| fosinoprilatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,4S)-4-cyclohexyl-1-{2-[hydroxy-(4-phenyl-butyl)-phosphinoyl]-acetyl}-pyrrolidine-2-carboxylic acid | ChEBI |
| (2S,4S)-4-cyclohexyl-1-{2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl}pyrrolidine-2-carboxylic acid | ChEBI |
| 4-Cyclohexyl-1-{2-[hydroxy-(4-phenyl-butyl)-phosphinoyl]-acetyl}-pyrrolidine-2-carboxylic acid | ChEMBL |
| (4S)-4-cyclohexyl-1-((hydroxy(4-phenylbutyl)phosphinyl)acetyl)-L-proline | ChemIDplus |
| fosinopril diacid | ChemIDplus |
| fosinoprilic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03772 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6492772 | Reaxys |
| CAS:95399-71-6 | ChemIDplus |
| CAS:95399-71-6 | KEGG DRUG |
| Citations |
|---|