EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12 |
| Net Charge | 0 |
| Average Mass | 228.294 |
| Monoisotopic Mass | 228.09390 |
| SMILES | c1ccc2cc3c(ccc4ccccc43)cc2c1 |
| InChI | InChI=1S/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H |
| InChIKey | DXBHBZVCASKNBY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetraphene (CHEBI:51348) is a ortho-fused polycyclic arene (CHEBI:35296) |
| tetraphene (CHEBI:51348) is a tetraphenes (CHEBI:51067) |
| Incoming Relation(s) |
| 7-bromomethyl-12-methyltetraphene (CHEBI:20787) has parent hydride tetraphene (CHEBI:51348) |
| benz[a]anthracene 5,6-oxide (CHEBI:142240) has parent hydride tetraphene (CHEBI:51348) |
| tetraphen-1-ol (CHEBI:132369) has parent hydride tetraphene (CHEBI:51348) |
| IUPAC Name |
|---|
| tetraphene |
| Synonyms | Source |
|---|---|
| 1,2-Benzanthracene | KEGG COMPOUND |
| 1,2-Benzanthrazen | ChemIDplus |
| 2,3-benzphenanthrene | ChemIDplus |
| Benz[a]anthracene | KEGG COMPOUND |
| benzanthrene | NIST Chemistry WebBook |
| naphthanthracene | ChemIDplus |
| Citations |
|---|