EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15Br |
| Net Charge | 0 |
| Average Mass | 335.244 |
| Monoisotopic Mass | 334.03571 |
| SMILES | Cc1c2ccccc2c(CBr)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C20H15Br/c1-13-15-7-4-5-9-17(15)19(12-21)18-11-10-14-6-2-3-8-16(14)20(13)18/h2-11H,12H2,1H3 |
| InChIKey | IBWBDNBSIFGSLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-bromomethyl-12-methyltetraphene (CHEBI:20787) has parent hydride tetraphene (CHEBI:51348) |
| 7-bromomethyl-12-methyltetraphene (CHEBI:20787) has role mutagen (CHEBI:25435) |
| 7-bromomethyl-12-methyltetraphene (CHEBI:20787) is a organobromine compound (CHEBI:37141) |
| 7-bromomethyl-12-methyltetraphene (CHEBI:20787) is a tetraphenes (CHEBI:51067) |
| IUPAC Name |
|---|
| 7-(bromomethyl)-12-methyltetraphene |
| Synonyms | Source |
|---|---|
| 7-bromomethyl-12-methylbenzanthracene | ChemIDplus |
| 7-bromomethyl-12-methylbenz[a]anthracene | ChemIDplus |
| 7-BrMe-12-MeBA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2056479 | Reaxys |
| CAS:16238-56-5 | ChemIDplus |
| Citations |
|---|