EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O |
| Net Charge | 0 |
| Average Mass | 244.293 |
| Monoisotopic Mass | 244.08882 |
| SMILES | c1ccc2c(c1)-c1cc3ccccc3cc1C1OC21 |
| InChI | InChI=1S/C18H12O/c1-2-6-12-10-16-15(9-11(12)5-1)13-7-3-4-8-14(13)17-18(16)19-17/h1-10,17-18H |
| InChIKey | APIRAYPNDXRJBP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benz[a]anthracene 5,6-oxide (CHEBI:142240) has parent hydride tetraphene (CHEBI:51348) |
| benz[a]anthracene 5,6-oxide (CHEBI:142240) has role mutagen (CHEBI:25435) |
| benz[a]anthracene 5,6-oxide (CHEBI:142240) is a arene epoxide (CHEBI:37410) |
| benz[a]anthracene 5,6-oxide (CHEBI:142240) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| 1a,11b-dihydrotetrapheno[5,6-b]oxirene |
| Synonyms | Source |
|---|---|
| 1a,11b-dihydrobenzo[3,4]anthra[1,2-b]oxirene | IUPAC |
| 3,4-dihydro-3,4-epoxy-1,2-benzanthracene | ChemIDplus |
| 5,6-epoxy-5,6-dihydrobeno[a]anthracene | ChEBI |
| 5,6-epoxy-5,6-dihydrobenz(a)anthracene | ChemIDplus |
| 5,6-epoxy-5,6-dihydrobenz[a]anthracene | ChemIDplus |
| BA 5,6-oxide | ChEBI |
| Citations |
|---|