EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)O |
| InChI | InChI=1S/C19H38O2/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(20)21/h15-18H,6-14H2,1-5H3,(H,20,21) |
| InChIKey | PAHGJZDQXIOYTH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pristanic acid (CHEBI:51340) has role human metabolite (CHEBI:77746) |
| pristanic acid (CHEBI:51340) is a branched-chain saturated fatty acid (CHEBI:39417) |
| pristanic acid (CHEBI:51340) is a long-chain fatty acid (CHEBI:15904) |
| pristanic acid (CHEBI:51340) is a methyl-branched fatty acid (CHEBI:62499) |
| pristanic acid (CHEBI:51340) is conjugate acid of pristanate (CHEBI:77268) |
| Incoming Relation(s) |
| pristanoyl-CoA (CHEBI:51341) has functional parent pristanic acid (CHEBI:51340) |
| (2R,6S,10S)-2,6,10,14-pristanic acid (CHEBI:143967) is a pristanic acid (CHEBI:51340) |
| pristanate (CHEBI:77268) is conjugate base of pristanic acid (CHEBI:51340) |
| IUPAC Name |
|---|
| 2,6,10,14-tetramethylpentadecanoic acid |
| Synonyms | Source |
|---|---|
| 2,6,10,14-Tetramethyl-pentadecansäure | ChEBI |
| 2,6,10,14-tetramethylpentadecylic acid | ChEBI |
| acide pristanique | ChEBI |
| ácido pristánico | ChEBI |
| Pristaninsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020250 | LIPID MAPS |
| PRISTANATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1786841 | Reaxys |
| CAS:1189-37-3 | ChemIDplus |
| Citations |
|---|