EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CC(C)CCC[C@H](C)CCC[C@H](C)CCC[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H38O2/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(20)21/h15-18H,6-14H2,1-5H3,(H,20,21)/t16-,17-,18+/m0/s1 |
| InChIKey | PAHGJZDQXIOYTH-OKZBNKHCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,6S,10S)-2,6,10,14-pristanic acid (CHEBI:143967) is a pristanic acid (CHEBI:51340) |
| IUPAC Name |
|---|
| (2R,6S,10S)-2,6,10,14-tetramethylpentadecanoic acid |