EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37O2 |
| Net Charge | -1 |
| Average Mass | 297.503 |
| Monoisotopic Mass | 297.27990 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C19H38O2/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(20)21/h15-18H,6-14H2,1-5H3,(H,20,21)/p-1 |
| InChIKey | PAHGJZDQXIOYTH-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pristanate (CHEBI:77268) is a 2-methyl fatty acid anion (CHEBI:83976) |
| pristanate (CHEBI:77268) is a long-chain fatty acid anion (CHEBI:57560) |
| pristanate (CHEBI:77268) is a methyl-branched fatty acid anion (CHEBI:67013) |
| pristanate (CHEBI:77268) is conjugate base of pristanic acid (CHEBI:51340) |
| Incoming Relation(s) |
| pristanic acid (CHEBI:51340) is conjugate acid of pristanate (CHEBI:77268) |
| IUPAC Name |
|---|
| 2,6,10,14-tetramethylpentadecanoate |
| UniProt Name | Source |
|---|---|
| 2,6,10,14-tetramethylpentadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PRISTANATE | MetaCyc |
| Citations |
|---|