EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5128 - flurazepam
| Formula | C21H23ClFN3O |
| Net Charge | 0 |
| Average Mass | 387.886 |
| Monoisotopic Mass | 387.15137 |
| SMILES | CCN(CC)CCN1C(=O)CN=C(c2ccccc2F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H23ClFN3O/c1-3-25(4-2)11-12-26-19-10-9-15(22)13-17(19)21(24-14-20(26)27)16-7-5-6-8-18(16)23/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | SAADBVWGJQAEFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flurazepam (CHEBI:5128) has role anticonvulsant (CHEBI:35623) |
| flurazepam (CHEBI:5128) has role antidepressant (CHEBI:35469) |
| flurazepam (CHEBI:5128) has role antipsychotic agent (CHEBI:35476) |
| flurazepam (CHEBI:5128) has role anxiolytic drug (CHEBI:35474) |
| flurazepam (CHEBI:5128) has role GABAA receptor agonist (CHEBI:91016) |
| flurazepam (CHEBI:5128) has role sedative (CHEBI:35717) |
| flurazepam (CHEBI:5128) is a 1,4-benzodiazepinone (CHEBI:35500) |
| flurazepam (CHEBI:5128) is a monofluorobenzenes (CHEBI:83575) |
| flurazepam (CHEBI:5128) is a organochlorine compound (CHEBI:36683) |
| flurazepam (CHEBI:5128) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| hydroxyethylflurazepam (CHEBI:143437) has functional parent flurazepam (CHEBI:5128) |
| IUPAC Name |
|---|
| 7-chloro-1-[2-(diethylamino)ethyl]-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| INNs | Source |
|---|---|
| flurazepam | WHO MedNet |
| flurazepam | WHO MedNet |
| flurazépam | WHO MedNet |
| flurazepamum | WHO MedNet |
| Synonym | Source |
|---|---|
| Ro 5-6901 | DrugBank |
| Brand Name | Source |
|---|---|
| Insumin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1218 | DrugCentral |
| D00329 | KEGG DRUG |
| DB00690 | DrugBank |
| FL7 | PDBeChem |
| Flurazepam | Wikipedia |
| HMDB0014828 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:17617-23-1 | NIST Chemistry WebBook |
| CAS:17617-23-1 | ChemIDplus |
| CAS:17617-23-1 | KEGG COMPOUND |
| Citations |
|---|