EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5128 - flurazepam
| Formula | C21H23ClFN3O |
| Net Charge | 0 |
| Average Mass | 387.886 |
| Monoisotopic Mass | 387.15137 |
| SMILES | CCN(CC)CCN1C(=O)CN=C(c2ccccc2F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H23ClFN3O/c1-3-25(4-2)11-12-26-19-10-9-15(22)13-17(19)21(24-14-20(26)27)16-7-5-6-8-18(16)23/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | SAADBVWGJQAEFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anticonvulsant A drug used to prevent seizures or reduce their severity. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flurazepam (CHEBI:5128) has role anticonvulsant (CHEBI:35623) |
| flurazepam (CHEBI:5128) has role anxiolytic drug (CHEBI:35474) |
| flurazepam (CHEBI:5128) has role GABAA receptor agonist (CHEBI:91016) |
| flurazepam (CHEBI:5128) has role sedative (CHEBI:35717) |
| flurazepam (CHEBI:5128) is a 1,4-benzodiazepinone (CHEBI:35500) |
| flurazepam (CHEBI:5128) is a monofluorobenzenes (CHEBI:83575) |
| flurazepam (CHEBI:5128) is a organochlorine compound (CHEBI:36683) |
| flurazepam (CHEBI:5128) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| hydroxyethylflurazepam (CHEBI:143437) has functional parent flurazepam (CHEBI:5128) |
| IUPAC Name |
|---|
| 7-chloro-1-[2-(diethylamino)ethyl]-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| INNs | Source |
|---|---|
| flurazepam | WHO MedNet |
| flurazepam | WHO MedNet |
| flurazépam | WHO MedNet |
| flurazepamum | WHO MedNet |
| Synonym | Source |
|---|---|
| Ro 5-6901 | DrugBank |
| Brand Name | Source |
|---|---|
| Insumin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00329 | KEGG DRUG |
| 1218 | DrugCentral |
| DB00690 | DrugBank |
| HMDB0014828 | HMDB |
| Flurazepam | Wikipedia |
| FL7 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:17617-23-1 | KEGG COMPOUND |
| CAS:17617-23-1 | ChemIDplus |
| CAS:17617-23-1 | NIST Chemistry WebBook |
| Citations |
|---|