EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N3O5S.Na |
| Net Charge | 0 |
| Average Mass | 387.393 |
| Monoisotopic Mass | 387.08649 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1.[Na+] |
| InChI | InChI=1S/C16H19N3O5S.Na/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);/q;+1/p-1/t9-,10-,11+,14-;/m1./s1 |
| InChIKey | BYHDFCISJXIVBV-YWUHCJSESA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicillin sodium (CHEBI:51255) has part amoxicillin(1−) (CHEBI:51256) |
| amoxicillin sodium (CHEBI:51255) has role antiinfective agent (CHEBI:35441) |
| amoxicillin sodium (CHEBI:51255) has role antimicrobial agent (CHEBI:33281) |
| amoxicillin sodium (CHEBI:51255) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 6β-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| Acuotricina | ChemIDplus |
| Amoxicillin (as the sodium salt) | ChEMBL |
| amoxicillin natrium | ChemIDplus |
| amoxicillin sodium salt | ChEBI |
| Amoxycillin (as sodium) | ChEMBL |
| amoxycillin sodium | ChEBI |
| Brand Name | Source |
|---|---|
| Ibiamox | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02925 | KEGG DRUG |
| DBSALT000868 | DrugBank |
| WO2011158133 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6050145 | Reaxys |
| CAS:34642-77-8 | ChemIDplus |
| Citations |
|---|