EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8 |
| Net Charge | 0 |
| Average Mass | 444.440 |
| Monoisotopic Mass | 444.15327 |
| SMILES | [H][C@@]12C(=C(O)[C@]3(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]3([H])[C@H]1O)C(=O)c1c(O)cccc1[C@@H]2C |
| InChI | InChI=1S/C22H24N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-7,10,14-15,17,25,27-29,32H,1-3H3,(H2,23,31)/t7-,10+,14+,15-,17-,22-/m0/s1 |
| InChIKey | JBIWCJUYHHGXTC-AKNGSSGZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antibacterial drug A drug used to treat or prevent bacterial infections. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxycycline (CHEBI:50845) has role anti-inflammatory agent (CHEBI:67079) |
| doxycycline (CHEBI:50845) has role antibacterial drug (CHEBI:36047) |
| doxycycline (CHEBI:50845) has role antimalarial (CHEBI:38068) |
| doxycycline (CHEBI:50845) has role geroprotector (CHEBI:176497) |
| doxycycline (CHEBI:50845) has role immunomodulator (CHEBI:50846) |
| doxycycline (CHEBI:50845) is a tetracyclines (CHEBI:26895) |
| Incoming Relation(s) |
| doxycycline HCl (CHEBI:652992) has part doxycycline (CHEBI:50845) |
| doxycycline monohydrate (CHEBI:60648) has part doxycycline (CHEBI:50845) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| doxiciclina | ChemIDplus |
| doxycycline | KEGG DRUG |
| doxycyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4S,4AR,5S,5AR,6R,12AS)-4-(DIMETHYLAMINO)-3,5,10,12,12A-PENTAHYDROXY-6-METHYL-1,11-DIOXO-1,4,4A,5,5A,6,11,12A-OCTAHYDROTETRACENE-2-CARBOXAMIDE | PDBeChem |
| 5-hydroxy-α-6-deoxytetracycline | ChemIDplus |
| 6α-deoxy-5-oxytetracycline | ChemIDplus |
| Doxycyclin | ChEBI |
| Doxycycline | KEGG COMPOUND |
| doxycycline (anhydrous) | ChemIDplus |
| Brand Names | Source |
|---|---|
| Jenacyclin | DrugBank |
| Supracyclin | DrugBank |
| Vibramycin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 10469369 | ChemSpider |
| 1840 | VSDB |
| 961 | DrugCentral |
| C00017127 | KNApSAcK |
| C06973 | KEGG COMPOUND |
| CPD-19256 | MetaCyc |
| D07876 | KEGG DRUG |
| DB00254 | DrugBank |
| Doxycycline | Wikipedia |
| DXT | PDBeChem |
| HMDB0014399 | HMDB |
| LMPK07000001 | LIPID MAPS |
| US3019260 | Patent |
| US3200149 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3041790 | Reaxys |
| CAS:564-25-0 | KEGG COMPOUND |
| CAS:564-25-0 | ChemIDplus |
| Citations |
|---|