EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N2O8.Cl |
| Net Charge | 0 |
| Average Mass | 480.901 |
| Monoisotopic Mass | 480.12994 |
| SMILES | [Cl-].[H][C@@]12C(=C(O)[C@]3(O)C(=O)C(C(N)=O)=C(O)[C@@H]([NH+](C)C)[C@]3([H])[C@H]1O)C(=O)c1c(O)cccc1[C@@H]2C |
| InChI | InChI=1S/C22H24N2O8.ClH/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29;/h4-7,10,14-15,17,25,27-29,32H,1-3H3,(H2,23,31);1H/t7-,10+,14+,15-,17-,22-;/m0./s1 |
| InChIKey | RUYHIJHUVHIMIR-CVHRZJFOSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxycycline HCl (CHEBI:652992) has part doxycycline (CHEBI:50845) |
| doxycycline HCl (CHEBI:652992) has role geroprotector (CHEBI:176497) |
| doxycycline HCl (CHEBI:652992) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| doxycycline hyclate (CHEBI:34730) has part doxycycline HCl (CHEBI:652992) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| (1S,4aS,11R,11aR,12S,12aR)-3-carbamoyl-2,4a,5,7,12-pentahydroxy-N,N,11-trimethyl-4,6-dioxo-1,4,4a,6,11,11a,12,12a-octahydrotetracen-1-aminium chloride | IUPAC |
| 6-desoxy-5-hydroxytetracycline hydrochloride | ChemIDplus |
| Doxycycline HCl | ChEMBL |
| α-6-deoxy-5-hydroxytetracycline hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07877 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5702728 | Reaxys |
| CAS:10592-13-9 | ChemIDplus |
| CAS:10592-13-9 | KEGG DRUG |
| Citations |
|---|