EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8.H2O |
| Net Charge | 0 |
| Average Mass | 462.455 |
| Monoisotopic Mass | 462.16383 |
| SMILES | O.[H][C@@]12C(=C(O)[C@]3(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]3([H])[C@H]1O)C(=O)c1c(O)cccc1[C@@H]2C |
| InChI | InChI=1S/C22H24N2O8.H2O/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29;/h4-7,10,14-15,17,25,27-29,32H,1-3H3,(H2,23,31);1H2/t7-,10+,14+,15-,17-,22-;/m0./s1 |
| InChIKey | XQTWDDCIUJNLTR-CVHRZJFOSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxycycline monohydrate (CHEBI:60648) has part doxycycline (CHEBI:50845) |
| doxycycline monohydrate (CHEBI:60648) has role antibacterial drug (CHEBI:36047) |
| doxycycline monohydrate (CHEBI:60648) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,6R,12aS)-4-(dimethylamino)-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide—water (1/1) |
| INN | Source |
|---|---|
| doxycycline | ChemIDplus |
| Synonym | Source |
|---|---|
| doxycycline hydrate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:17086-28-1 | KEGG DRUG |
| CAS:17086-28-1 | ChemIDplus |