EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29ClO4 |
| Net Charge | 0 |
| Average Mass | 416.945 |
| Monoisotopic Mass | 416.17544 |
| SMILES | [H][C@@]12C=C(Cl)C3=CC(=O)[C@]4([H])C[C@]4([H])[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C24H29ClO4/c1-12(26)24(29-13(2)27)8-6-16-14-10-20(25)19-11-21(28)15-9-18(15)23(19,4)17(14)5-7-22(16,24)3/h10-11,14-18H,5-9H2,1-4H3/t14-,15+,16-,17-,18-,22-,23-,24-/m0/s1 |
| InChIKey | UWFYSQMTEOIJJG-FDTZYFLXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | progestin A synthetic progestogen. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyproterone acetate (CHEBI:50743) has functional parent cyproterone (CHEBI:50742) |
| cyproterone acetate (CHEBI:50743) has role androgen antagonist (CHEBI:35497) |
| cyproterone acetate (CHEBI:50743) has role geroprotector (CHEBI:176497) |
| cyproterone acetate (CHEBI:50743) has role progestin (CHEBI:59826) |
| cyproterone acetate (CHEBI:50743) is a 20-oxo steroid (CHEBI:36885) |
| cyproterone acetate (CHEBI:50743) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cyproterone acetate (CHEBI:50743) is a acetate ester (CHEBI:47622) |
| cyproterone acetate (CHEBI:50743) is a chlorinated steroid (CHEBI:77175) |
| cyproterone acetate (CHEBI:50743) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| 6-chloro-3,20-dioxo-1β,2β-dihydro-3'H-cyclopropa[1,2]pregna-4,6-dien-17-yl acetate |
| Synonyms | Source |
|---|---|
| 1,2α-methylene-6-chloro-17α-acetoxy-4,6-pregnadiene-3,20-dione | ChEBI |
| 1,2α-methylene-6-chloro-pregna-4,6-diene-3,20-dione 17α-acetate | ChemIDplus |
| 1,2α-methylene-6-chloro-Δ4,6-pregnadien-17α-ol-3,20-dione acetate | ChEBI |
| 17α-acetoxy-6-chloro-1α,2α-methylenepregna-4,6-diene-3,20-dione | ChEBI |
| (1R,3aS,3bR,7aR,8aS,8bS,8cS,10aS)-1-acetyl-5-chloro-8b,10a-dimethyl-7-oxo-1,2,3,3a,3b,7,7a,8,8a,8b,8c,9,10,10a-tetradecahydrocyclopenta[a]cyclopropa[g]phenanthren-1-yl acetate | IUPAC |
| (1β,2β)-17-(acetyloxy)-6-chloro-1,2-dihydro-3'H-cyclopropa[1,2]pregna-1,4,6-triene-3,20-dione | ChEBI |
| Brand Names | Source |
|---|---|
| Androcur | DrugBank |
| Apo-cyproterone | DrugBank |
| Cyprostat | ChemIDplus |
| Citations |
|---|