EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClO3 |
| Net Charge | 0 |
| Average Mass | 374.908 |
| Monoisotopic Mass | 374.16487 |
| SMILES | [H][C@@]12C=C(Cl)C3=CC(=O)[C@]4([H])C[C@]4([H])[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(C)=O |
| InChI | InChI=1S/C22H27ClO3/c1-11(24)22(26)7-5-14-12-9-18(23)17-10-19(25)13-8-16(13)21(17,3)15(12)4-6-20(14,22)2/h9-10,12-16,26H,4-8H2,1-3H3/t12-,13+,14-,15-,16-,20-,21-,22-/m0/s1 |
| InChIKey | DUSHUSLJJMDGTE-ZJPMUUANSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyproterone (CHEBI:50742) has parent hydride pregnane (CHEBI:8386) |
| cyproterone (CHEBI:50742) has role androgen antagonist (CHEBI:35497) |
| cyproterone (CHEBI:50742) is a 17α-hydroxy steroid (CHEBI:35342) |
| cyproterone (CHEBI:50742) is a 20-oxo steroid (CHEBI:36885) |
| cyproterone (CHEBI:50742) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cyproterone (CHEBI:50742) is a chlorinated steroid (CHEBI:77175) |
| cyproterone (CHEBI:50742) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| cyproterone acetate (CHEBI:50743) has functional parent cyproterone (CHEBI:50742) |
| IUPAC Name |
|---|
| 6-chloro-17-hydroxy-1β,2β-dihydro-3'H-cyclopropa[1,2]pregna-4,6-diene-3,20-dione |
| INNs | Source |
|---|---|
| ciproterona | ChemIDplus |
| cyproterone | ChemIDplus |
| cyproteronum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-Chlor-δ6-1,2-α-methylen-17-α-hydroxyprogesteron | ChemIDplus |
| Ciproterone | ChemIDplus |
| Brand Names | Source |
|---|---|
| Apo-cyproterone | DrugBank |
| Novo-cyproterone | DrugBank |