EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50714 - hexahomomethionine
| Formula | C11H23NO2S |
| Net Charge | 0 |
| Average Mass | 233.377 |
| Monoisotopic Mass | 233.14495 |
| SMILES | CSCCCCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C11H23NO2S/c1-15-9-7-5-3-2-4-6-8-10(12)11(13)14/h10H,2-9,12H2,1H3,(H,13,14) |
| InChIKey | XVGBKWQWYRNGDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexahomomethionine (CHEBI:50714) is a methyl sulfide (CHEBI:86315) |
| hexahomomethionine (CHEBI:50714) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| hexahomomethionine (CHEBI:50714) is a sulfur-containing amino acid (CHEBI:26834) |
| hexahomomethionine (CHEBI:50714) is tautomer of hexahomomethionine zwitterion (CHEBI:58836) |
| Incoming Relation(s) |
| N-hydroxyhexahomomethionine (CHEBI:50764) has functional parent hexahomomethionine (CHEBI:50714) |
| N,N-dihydroxyhexahomomethionine (CHEBI:50765) has functional parent hexahomomethionine (CHEBI:50714) |
| hexahomomethionine S-oxide (CHEBI:91226) has functional parent hexahomomethionine (CHEBI:50714) |
| L-hexahomomethionine (CHEBI:137005) is a hexahomomethionine (CHEBI:50714) |
| hexahomomethionine zwitterion (CHEBI:58836) is tautomer of hexahomomethionine (CHEBI:50714) |
| IUPAC Name |
|---|
| 2-amino-10-(methylsulfanyl)decanoic acid |