EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23NO3S |
| Net Charge | 0 |
| Average Mass | 249.376 |
| Monoisotopic Mass | 249.13986 |
| SMILES | CSCCCCCCCCC(NO)C(=O)O |
| InChI | InChI=1S/C11H23NO3S/c1-16-9-7-5-3-2-4-6-8-10(12-15)11(13)14/h10,12,15H,2-9H2,1H3,(H,13,14) |
| InChIKey | YUVSLMOWLXLZEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxyhexahomomethionine (CHEBI:50764) has functional parent hexahomomethionine (CHEBI:50714) |
| N-hydroxyhexahomomethionine (CHEBI:50764) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxyhexahomomethionine (CHEBI:50764) is conjugate acid of N-hydroxyhexahomomethioninate (CHEBI:58844) |
| Incoming Relation(s) |
| N-hydroxy-L-hexahomomethionine (CHEBI:137026) is a N-hydroxyhexahomomethionine (CHEBI:50764) |
| N-hydroxyhexahomomethioninate (CHEBI:58844) is conjugate base of N-hydroxyhexahomomethionine (CHEBI:50764) |
| IUPAC Name |
|---|
| 2-(hydroxyamino)-10-(methylsulfanyl)decanoic acid |