EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23NO3S |
| Net Charge | 0 |
| Average Mass | 249.376 |
| Monoisotopic Mass | 249.13986 |
| SMILES | CS(=O)CCCCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C11H23NO3S/c1-16(15)9-7-5-3-2-4-6-8-10(12)11(13)14/h10H,2-9,12H2,1H3,(H,13,14) |
| InChIKey | QRXRWDDFTQIZAV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexahomomethionine S-oxide (CHEBI:91226) has functional parent hexahomomethionine (CHEBI:50714) |
| hexahomomethionine S-oxide (CHEBI:91226) has role plant metabolite (CHEBI:76924) |
| hexahomomethionine S-oxide (CHEBI:91226) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| hexahomomethionine S-oxide (CHEBI:91226) is a sulfoxide (CHEBI:22063) |
| hexahomomethionine S-oxide (CHEBI:91226) is a sulfur-containing amino acid (CHEBI:26834) |
| IUPAC Name |
|---|
| 2-amino-10-(methanesulfinyl)decanoic acid |
| Synonyms | Source |
|---|---|
| 2-amino-10-(methylsulfinyl)decanoic acid | ChEBI |
| hexahomo-Met S-oxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28063957 | Reaxys |
| Citations |
|---|