EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50713 - pentahomomethionine
| Formula | C10H21NO2S |
| Net Charge | 0 |
| Average Mass | 219.350 |
| Monoisotopic Mass | 219.12930 |
| SMILES | CSCCCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C10H21NO2S/c1-14-8-6-4-2-3-5-7-9(11)10(12)13/h9H,2-8,11H2,1H3,(H,12,13) |
| InChIKey | GYYOKOIBHIWNHE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentahomomethionine (CHEBI:50713) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| pentahomomethionine (CHEBI:50713) is a sulfur-containing amino acid (CHEBI:26834) |
| pentahomomethionine (CHEBI:50713) is tautomer of pentahomomethionine zwitterion (CHEBI:58835) |
| Incoming Relation(s) |
| N-hydroxypentahomomethionine (CHEBI:50763) has functional parent pentahomomethionine (CHEBI:50713) |
| N,N-dihydroxypentahomomethionine (CHEBI:50770) has functional parent pentahomomethionine (CHEBI:50713) |
| pentahomomethionine S-oxide (CHEBI:91225) has functional parent pentahomomethionine (CHEBI:50713) |
| L-pentahomomethionine (CHEBI:137004) is a pentahomomethionine (CHEBI:50713) |
| pentahomomethionine zwitterion (CHEBI:58835) is tautomer of pentahomomethionine (CHEBI:50713) |
| IUPAC Name |
|---|
| 2-amino-9-(methylsulfanyl)nonanoic acid |