EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21NO3S |
| Net Charge | 0 |
| Average Mass | 235.349 |
| Monoisotopic Mass | 235.12421 |
| SMILES | CSCCCCCCCC(NO)C(=O)O |
| InChI | InChI=1S/C10H21NO3S/c1-15-8-6-4-2-3-5-7-9(11-14)10(12)13/h9,11,14H,2-8H2,1H3,(H,12,13) |
| InChIKey | DPWLWTOLQTUIJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxypentahomomethionine (CHEBI:50763) has functional parent pentahomomethionine (CHEBI:50713) |
| N-hydroxypentahomomethionine (CHEBI:50763) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxypentahomomethionine (CHEBI:50763) is conjugate acid of N-hydroxypentahomomethioninate (CHEBI:58843) |
| Incoming Relation(s) |
| N-hydroxy-L-pentahomomethionine (CHEBI:137025) is a N-hydroxypentahomomethionine (CHEBI:50763) |
| N-hydroxypentahomomethioninate (CHEBI:58843) is conjugate base of N-hydroxypentahomomethionine (CHEBI:50763) |
| IUPAC Name |
|---|
| 2-(hydroxyamino)-9-(methylsulfanyl)nonanoic acid |