EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21NO4S |
| Net Charge | 0 |
| Average Mass | 251.348 |
| Monoisotopic Mass | 251.11913 |
| SMILES | CSCCCCCCCC(C(=O)O)N(O)O |
| InChI | InChI=1S/C10H21NO4S/c1-16-8-6-4-2-3-5-7-9(10(12)13)11(14)15/h9,14-15H,2-8H2,1H3,(H,12,13) |
| InChIKey | RIBOHFDQFNREER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxypentahomomethionine (CHEBI:50770) has functional parent pentahomomethionine (CHEBI:50713) |
| N,N-dihydroxypentahomomethionine (CHEBI:50770) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxypentahomomethionine (CHEBI:50770) is conjugate acid of N,N-dihydroxypentahomomethioninate (CHEBI:58849) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-pentahomomethionine (CHEBI:137030) is a N,N-dihydroxypentahomomethionine (CHEBI:50770) |
| N,N-dihydroxypentahomomethioninate (CHEBI:58849) is conjugate base of N,N-dihydroxypentahomomethionine (CHEBI:50770) |
| IUPAC Name |
|---|
| 2-(dihydroxyamino)-9-(methylsulfanyl)nonanoic acid |