EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N8O5 |
| Net Charge | -2 |
| Average Mass | 452.431 |
| Monoisotopic Mass | 452.15676 |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/p-2/t13-/m0/s1 |
| InChIKey | FBOZXECLQNJBKD-ZDUSSCGKSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methotrexate(2−) (CHEBI:50681) is a dicarboxylic acid dianion (CHEBI:28965) |
| methotrexate(2−) (CHEBI:50681) is conjugate base of methotrexate(1−) (CHEBI:50680) |
| Incoming Relation(s) |
| methotrexate disodium (CHEBI:50679) has part methotrexate(2−) (CHEBI:50681) |
| methotrexate(1−) (CHEBI:50680) is conjugate acid of methotrexate(2−) (CHEBI:50681) |
| IUPAC Name |
|---|
| (2S)-2-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzamido)pentanedioate |
| UniProt Name | Source |
|---|---|
| methotrexate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6081035 | Beilstein |