EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N8O5.2Na |
| Net Charge | 0 |
| Average Mass | 498.411 |
| Monoisotopic Mass | 498.13520 |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C20H22N8O5.2Na/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30;;/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27);;/q;2*+1/p-2/t13-;;/m0../s1 |
| InChIKey | DASQOOZCTWOQPA-GXKRWWSZSA-L |
| Roles Classification |
|---|
| Biological Role: | EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methotrexate disodium (CHEBI:50679) has part methotrexate(2−) (CHEBI:50681) |
| methotrexate disodium (CHEBI:50679) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| methotrexate disodium (CHEBI:50679) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (2S)-2-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzamido)pentanedioate |
| Synonym | Source |
|---|---|
| methotrexate sodium | ChEBI |
| Brand Names | Source |
|---|---|
| Emtexate | DrugBank |
| Ledertrexate | DrugBank |
| Rheumatrex | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB00563 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6045736 | Beilstein |