EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N8O5 |
| Net Charge | -1 |
| Average Mass | 453.439 |
| Monoisotopic Mass | 453.16404 |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/p-1/t13-/m0/s1 |
| InChIKey | FBOZXECLQNJBKD-ZDUSSCGKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methotrexate(1−) (CHEBI:50680) is a dicarboxylic acid monoanion (CHEBI:35695) |
| methotrexate(1−) (CHEBI:50680) is conjugate acid of methotrexate(2−) (CHEBI:50681) |
| methotrexate(1−) (CHEBI:50680) is conjugate base of methotrexate (CHEBI:44185) |
| Incoming Relation(s) |
| methotrexate monosodium (CHEBI:50682) has part methotrexate(1−) (CHEBI:50680) |
| methotrexate (CHEBI:44185) is conjugate acid of methotrexate(1−) (CHEBI:50680) |
| methotrexate(2−) (CHEBI:50681) is conjugate base of methotrexate(1−) (CHEBI:50680) |
| IUPAC Name |
|---|
| (2S)-4-carboxy-2-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzamido)butanoate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5197927 | Beilstein |