EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27O2 |
| Net Charge | -1 |
| Average Mass | 299.434 |
| Monoisotopic Mass | 299.20165 |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\C(=O)[O-])C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/p-1/b9-6+,12-11+,15-8-,16-14+ |
| InChIKey | SHGAZHPCJJPHSC-ZVCIMWCZSA-M |
| Roles Classification |
|---|
| Biological Roles: | retinoid X receptor agonist An agonist that selectively binds to and activates a retinoid X receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-cis-retinoate (CHEBI:78630) has role antineoplastic agent (CHEBI:35610) |
| 9-cis-retinoate (CHEBI:78630) has role keratolytic drug (CHEBI:50176) |
| 9-cis-retinoate (CHEBI:78630) has role metabolite (CHEBI:25212) |
| 9-cis-retinoate (CHEBI:78630) has role retinoid X receptor agonist (CHEBI:63794) |
| 9-cis-retinoate (CHEBI:78630) is a retinoate (CHEBI:15036) |
| 9-cis-retinoate (CHEBI:78630) is conjugate base of 9-cis-retinoic acid (CHEBI:50648) |
| Incoming Relation(s) |
| 9-cis-retinoic acid (CHEBI:50648) is conjugate acid of 9-cis-retinoate (CHEBI:78630) |
| IUPAC Name |
|---|
| (9cis)-15-oxidoretinal |
| Synonym | Source |
|---|---|
| (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 9-cis-retinoate | UniProt |