EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N2O2 |
| Net Charge | 0 |
| Average Mass | 372.553 |
| Monoisotopic Mass | 372.27768 |
| SMILES | [H][C@@]12CC[C@@]3([H])NC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])C(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H36N2O2/c1-21(2,3)25-20(27)17-8-7-15-14-6-9-18-23(5,13-11-19(26)24-18)16(14)10-12-22(15,17)4/h11,13-18H,6-10,12H2,1-5H3,(H,24,26)(H,25,27)/t14-,15-,16-,17+,18+,22-,23+/m0/s1 |
| InChIKey | DBEPLOCGEIEOCV-WSBQPABSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | antihyperplasia drug A drug used for the treatment of hyperplasia (increaced cell production within an organ or tissue). androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| finasteride (CHEBI:5062) has parent hydride 5α-androstane (CHEBI:28859) |
| finasteride (CHEBI:5062) has role androgen antagonist (CHEBI:35497) |
| finasteride (CHEBI:5062) has role antihyperplasia drug (CHEBI:59844) |
| finasteride (CHEBI:5062) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| finasteride (CHEBI:5062) is a 3-oxo steroid (CHEBI:47788) |
| finasteride (CHEBI:5062) is a aza-steroid (CHEBI:35726) |
| finasteride (CHEBI:5062) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| N-tert-butyl-3-oxo-4-aza-5α-androst-1-ene-17β-carboxamide |
| INNs | Source |
|---|---|
| finasterida | DrugBank |
| finasteride | KEGG DRUG |
| finasteridum | DrugBank |
| Synonym | Source |
|---|---|
| (5alpha,17beta)-(1,1-Dimethylethyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1171 | DrugCentral |
| D00321 | KEGG DRUG |
| DB01216 | DrugBank |
| EP155096 | Patent |
| Finasteride | Wikipedia |
| HMDB0001984 | HMDB |
| LSM-1999 | LINCS |
| US4760071 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4269024 | Reaxys |
| CAS:98319-26-7 | ChemIDplus |
| CAS:98319-26-7 | KEGG DRUG |
| Citations |
|---|