EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O6 |
| Net Charge | 0 |
| Average Mass | 360.366 |
| Monoisotopic Mass | 360.13214 |
| SMILES | NC(Cc1ccc(O)c(-c2cc(CC(N)C(=O)O)ccc2O)c1)C(=O)O |
| InChI | InChI=1S/C18H20N2O6/c19-13(17(23)24)7-9-1-3-15(21)11(5-9)12-6-10(2-4-16(12)22)8-14(20)18(25)26/h1-6,13-14,21-22H,7-8,19-20H2,(H,23,24)(H,25,26) |
| InChIKey | OQALFHMKVSJFRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dityrosine (CHEBI:50607) has role biomarker (CHEBI:59163) |
| dityrosine (CHEBI:50607) is a biphenyls (CHEBI:22888) |
| dityrosine (CHEBI:50607) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| dityrosine (CHEBI:50607) is a tyrosine derivative (CHEBI:62761) |
| Incoming Relation(s) |
| N,N'-diformyldityrosine (CHEBI:50611) has functional parent dityrosine (CHEBI:50607) |
| DD-dityrosine (CHEBI:50610) is a dityrosine (CHEBI:50607) |
| LL-dityrosine (CHEBI:50609) is a dityrosine (CHEBI:50607) |
| IUPAC Name |
|---|
| 3,3'-(6,6'-dihydroxybiphenyl-3,3'-diyl)bis(2-aminopropanoic acid) |
| Synonyms | Source |
|---|---|
| α,α'-diamino-6,6'-dihydroxy-(1,1'-biphenyl)-3,3'-dipropanoic acid | ChemIDplus |
| bityrosine | ChemIDplus |
| o,o-dityrosine | ChemIDplus |
| 3,3'-dityrosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2228674 | Beilstein |
| CAS:980-21-2 | ChemIDplus |
| Citations |
|---|