EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O6 |
| Net Charge | 0 |
| Average Mass | 360.366 |
| Monoisotopic Mass | 360.13214 |
| SMILES | N[C@@H](Cc1ccc(O)c(-c2cc(C[C@H](N)C(=O)O)ccc2O)c1)C(=O)O |
| InChI | InChI=1S/C18H20N2O6/c19-13(17(23)24)7-9-1-3-15(21)11(5-9)12-6-10(2-4-16(12)22)8-14(20)18(25)26/h1-6,13-14,21-22H,7-8,19-20H2,(H,23,24)(H,25,26)/t13-,14-/m0/s1 |
| InChIKey | OQALFHMKVSJFRR-KBPBESRZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LL-dityrosine (CHEBI:50609) is a dityrosine (CHEBI:50607) |
| LL-dityrosine (CHEBI:50609) is enantiomer of DD-dityrosine (CHEBI:50610) |
| Incoming Relation(s) |
| DD-dityrosine (CHEBI:50610) is enantiomer of LL-dityrosine (CHEBI:50609) |
| IUPAC Name |
|---|
| (2S,2'S)-3,3'-(6,6'-dihydroxybiphenyl-3,3'-diyl)bis(2-aminopropanoic acid) |
| Synonym | Source |
|---|---|
| 3,3'-di-L-tyrosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4912450 | Beilstein |