EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O8 |
| Net Charge | 0 |
| Average Mass | 416.386 |
| Monoisotopic Mass | 416.12197 |
| SMILES | [H]C(=O)NC(Cc1ccc(O)c(-c2cc(CC(NC([H])=O)C(=O)O)ccc2O)c1)C(=O)O |
| InChI | InChI=1S/C20H20N2O8/c23-9-21-15(19(27)28)7-11-1-3-17(25)13(5-11)14-6-12(2-4-18(14)26)8-16(20(29)30)22-10-24/h1-6,9-10,15-16,25-26H,7-8H2,(H,21,23)(H,22,24)(H,27,28)(H,29,30) |
| InChIKey | OUNKRBSXIMLJRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-diformyldityrosine (CHEBI:50611) has functional parent dityrosine (CHEBI:50607) |
| N,N'-diformyldityrosine (CHEBI:50611) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N,N'-diformyldityrosine (CHEBI:50611) is a N-formyl amino acid (CHEBI:50759) |
| N,N'-diformyldityrosine (CHEBI:50611) is a biphenyls (CHEBI:22888) |
| IUPAC Name |
|---|
| 3,3'-(6,6'-dihydroxybiphenyl-3,3'-diyl)bis[2-(formylamino)propanoic acid] |
| Synonym | Source |
|---|---|
| N,N'-bisformyl dityrosine | ChEBI |