EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50512 - lidocaine hydrochloride
| Formula | C14H23N2O.Cl |
| Net Charge | 0 |
| Average Mass | 270.804 |
| Monoisotopic Mass | 270.14989 |
| SMILES | CC[NH+](CC)CC(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C14H22N2O.ClH/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H |
| InChIKey | IYBQHJMYDGVZRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lidocaine hydrochloride (CHEBI:50512) has part lidocaine (CHEBI:6456) |
| lidocaine hydrochloride (CHEBI:50512) has role anti-arrhythmia drug (CHEBI:38070) |
| lidocaine hydrochloride (CHEBI:50512) has role local anaesthetic (CHEBI:36333) |
| lidocaine hydrochloride (CHEBI:50512) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| lidocaine hydrochloride monohydrate (CHEBI:60791) has part lidocaine hydrochloride (CHEBI:50512) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-N2,N2-diethylglycinamide hydrochloride |
| Synonyms | Source |
|---|---|
| Lidocaine hydrochloride anhydrous | ChemIDplus |
| 2-Diethylamino-2',6'-acetoxylidide hydrochloride | ChemIDplus |
| alpha-Diethylamino-2,6-acetoxylidine hydrochloride | ChemIDplus |
| omega-Diethylamino-2,6-dimethylacetanilide hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alphacaine N | DrugBank |
| Anestacon | DrugBank |
| Esracaine | DrugBank |
| Alphacaine SP | DrugBank |
| Lidopen | ChEBI |
| Lidocaton | ChEBI |