EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O |
| Net Charge | 0 |
| Average Mass | 234.343 |
| Monoisotopic Mass | 234.17321 |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | NNJVILVZKWQKPM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lidocaine (CHEBI:6456) has functional parent glycinamide (CHEBI:42843) |
| lidocaine (CHEBI:6456) has role anti-arrhythmia drug (CHEBI:38070) |
| lidocaine (CHEBI:6456) has role drug allergen (CHEBI:88188) |
| lidocaine (CHEBI:6456) has role environmental contaminant (CHEBI:78298) |
| lidocaine (CHEBI:6456) has role local anaesthetic (CHEBI:36333) |
| lidocaine (CHEBI:6456) has role xenobiotic (CHEBI:35703) |
| lidocaine (CHEBI:6456) is a benzenes (CHEBI:22712) |
| lidocaine (CHEBI:6456) is a monocarboxylic acid amide (CHEBI:29347) |
| lidocaine (CHEBI:6456) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| lidocaine hydrochloride (CHEBI:50512) has part lidocaine (CHEBI:6456) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-N2,N2-diethylglycinamide |
| Synonyms | Source |
|---|---|
| 2-(Diethylamino)-2',6'-acetoxylidide | ChemIDplus |
| 2-(Diethylamino)-N-(2,6-dimethylphenyl)acetamide | ChemIDplus |
| Lidocaine | KEGG DRUG |
| α-diethylamino-2,6-dimethylacetanilide | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Lidoderm | DrugBank |
| Citations |
|---|