EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6456 - lidocaine
| Formula | C14H22N2O |
| Net Charge | 0 |
| Average Mass | 234.343 |
| Monoisotopic Mass | 234.17321 |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | NNJVILVZKWQKPM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lidocaine (CHEBI:6456) has functional parent glycinamide (CHEBI:42843) |
| lidocaine (CHEBI:6456) has role anti-arrhythmia drug (CHEBI:38070) |
| lidocaine (CHEBI:6456) has role drug allergen (CHEBI:88188) |
| lidocaine (CHEBI:6456) has role environmental contaminant (CHEBI:78298) |
| lidocaine (CHEBI:6456) has role local anaesthetic (CHEBI:36333) |
| lidocaine (CHEBI:6456) has role xenobiotic (CHEBI:35703) |
| lidocaine (CHEBI:6456) is a benzenes (CHEBI:22712) |
| lidocaine (CHEBI:6456) is a monocarboxylic acid amide (CHEBI:29347) |
| lidocaine (CHEBI:6456) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| lidocaine hydrochloride (CHEBI:50512) has part lidocaine (CHEBI:6456) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-N2,N2-diethylglycinamide |
| Synonyms | Source |
|---|---|
| 2-(Diethylamino)-2',6'-acetoxylidide | ChemIDplus |
| 2-(Diethylamino)-N-(2,6-dimethylphenyl)acetamide | ChemIDplus |
| Lidocaine | KEGG DRUG |
| α-diethylamino-2,6-dimethylacetanilide | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Lidoderm | DrugBank |
| Citations |
|---|