EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N2O.Cl.H2O |
| Net Charge | 0 |
| Average Mass | 288.819 |
| Monoisotopic Mass | 288.16046 |
| SMILES | CC[NH+](CC)CC(=O)Nc1c(C)cccc1C.O.[Cl-] |
| InChI | InChI=1S/C14H22N2O.ClH.H2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;;/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H;1H2 |
| InChIKey | YECIFGHRMFEPJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lidocaine hydrochloride monohydrate (CHEBI:60791) has part lidocaine hydrochloride (CHEBI:50512) |
| lidocaine hydrochloride monohydrate (CHEBI:60791) has role anti-arrhythmia drug (CHEBI:38070) |
| lidocaine hydrochloride monohydrate (CHEBI:60791) has role local anaesthetic (CHEBI:36333) |
| lidocaine hydrochloride monohydrate (CHEBI:60791) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-N2,N2-diethylglycinamide hydrochloride—water (1/1) |
| Synonyms | Source |
|---|---|
| 2-(diethylamino)-2',6'-acetoxylidide monohydrochloride monohydrate | ChemIDplus |
| 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide monohydrochloride monohydrate | ChEBI |
| diethylaminoacet-2,6-xylidide hydrochloride monohydrate | ChemIDplus |
| lidocaine hydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Xylocard | ChEBI |