EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N |
| Net Charge | +1 |
| Average Mass | 188.294 |
| Monoisotopic Mass | 188.14338 |
| SMILES | [H][N+](C)(CC#C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C13H17N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,5-9,12H,10-11H2,2-3H3/p+1/t12-/m1/s1 |
| InChIKey | MEZLKOACVSPNER-GFCCVEGCSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-selegiline(1+) (CHEBI:50350) is a selegiline(1+) (CHEBI:51099) |
| (−)-selegiline(1+) (CHEBI:50350) is conjugate acid of (−)-selegiline (CHEBI:9086) |
| Incoming Relation(s) |
| selegiline hydrochloride (CHEBI:9087) has part (−)-selegiline(1+) (CHEBI:50350) |
| (−)-selegiline (CHEBI:9086) is conjugate base of (−)-selegiline(1+) (CHEBI:50350) |
| IUPAC Name |
|---|
| N-methyl-N-[(1R)-1-methyl-2-phenylethyl]prop-2-yn-1-aminium |