EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N.Cl |
| Net Charge | 0 |
| Average Mass | 223.747 |
| Monoisotopic Mass | 223.11278 |
| SMILES | [Cl-].[H][N+](C)(CC#C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C13H17N.ClH/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h1,5-9,12H,10-11H2,2-3H3;1H/t12-;/m1./s1 |
| InChIKey | IYETZZCWLLUHIJ-UTONKHPSSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selegiline hydrochloride (CHEBI:9087) has part (−)-selegiline(1+) (CHEBI:50350) |
| selegiline hydrochloride (CHEBI:9087) has role antiparkinson drug (CHEBI:48407) |
| selegiline hydrochloride (CHEBI:9087) has role dopaminergic agent (CHEBI:48560) |
| selegiline hydrochloride (CHEBI:9087) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| selegiline hydrochloride (CHEBI:9087) is a hydrochloride (CHEBI:36807) |
| selegiline hydrochloride (CHEBI:9087) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| N-methyl-N-[(1R)-1-methyl-2-phenylethyl]prop-2-yn-1-aminium chloride |
| INN | Source |
|---|---|
| selegiline hydrochloride | ChEBI |
| Synonyms | Source |
|---|---|
| (−)-phenylisopropylmethylpropynylamine | ChemIDplus |
| Selegiline HCl | ChemIDplus |
| Selegiline hydrochloride | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Eldepryl | KEGG DRUG |
| Zelapar | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6001504 | Beilstein |
| CAS:14611-52-0 | KEGG COMPOUND |
| CAS:14611-52-0 | ChemIDplus |