EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N |
| Net Charge | 0 |
| Average Mass | 187.286 |
| Monoisotopic Mass | 187.13610 |
| SMILES | C#CCN(C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C13H17N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,5-9,12H,10-11H2,2-3H3/t12-/m1/s1 |
| InChIKey | MEZLKOACVSPNER-GFCCVEGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-selegiline (CHEBI:9086) has role geroprotector (CHEBI:176497) |
| (−)-selegiline (CHEBI:9086) is a selegiline (CHEBI:50217) |
| (−)-selegiline (CHEBI:9086) is a terminal acetylenic compound (CHEBI:73477) |
| (−)-selegiline (CHEBI:9086) is conjugate base of (−)-selegiline(1+) (CHEBI:50350) |
| Incoming Relation(s) |
| (−)-selegiline(1+) (CHEBI:50350) is conjugate acid of (−)-selegiline (CHEBI:9086) |
| IUPAC Name |
|---|
| N-methyl-N-[(2R)-1-phenylpropan-2-yl]prop-2-yn-1-amine |
| INNs | Source |
|---|---|
| selegilina | ChemIDplus |
| selegiline | KEGG DRUG |
| selegilinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| L-Deprenalin | DrugBank |
| Selegiline | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| EmSam | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5863318 | Beilstein |
| CAS:14611-51-9 | KEGG COMPOUND |
| CAS:14611-51-9 | ChemIDplus |
| Citations |
|---|